![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Curriculum Description.doc | 07-Aug-2002 15:07 | 41K | |
| DHO Lab Handout.doc | 07-Aug-2002 15:07 | 45K | |
| Damped Harmonic Oscillator.smd | 07-Aug-2002 15:07 | 6.6K | |
| Model Physics Unit Using the Virtual Molecular Dynamics.ppt | 07-Aug-2002 15:07 | 159K | |
| Sound Wave Lab.smd | 07-Aug-2002 15:07 | 6.6K | |
| Speed of Sound Lab Handout.doc | 07-Aug-2002 15:07 | 34K | |
| cathy_abbott.jpg | 07-Aug-2002 15:07 | 33K | |
| index.htm | 07-Aug-2002 15:07 | 2.7K | |
| jackie_crowe.jpg | 07-Aug-2002 15:07 | 33K | |
